C13H18N2O6 — CID 107261003
N-(3-amino-2-hydroxy-3-oxopropyl)-3,4,5-trimethoxybenzamide (PubChem CID 107261003) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 107261003 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(O)C(N)=O)cc(OC)c1OC |
| InChI | InChI=1S/C13H18N2O6/c1-19-9-4-7(5-10(20-2)11(9)21-3)13(18)15-6-8(16)12(14)17/h4-5,8,16H,6H2,1-3H3,(H2,14,17)(H,15,18) |
| InChIKey | NSGBNBHGGJDOQF-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |