C18H28N2O10 — CID 177491562
3,4,5-trimethoxy-N-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]ethyl]benzamide (PubChem CID 177491562) has the molecular formula C18H28N2O10 and a molecular weight of 432.43 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 177491562 |
| Molecular Formula | C18H28N2O10 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCCNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc(OC)c1OC |
| InChI | InChI=1S/C18H28N2O10/c1-28-11-6-9(7-12(29-2)16(11)30-3)17(26)19-4-5-20-18(27)15(25)14(24)13(23)10(22)8-21/h6-7,10,13-15,21-25H,4-5,8H2,1-3H3,(H,19,26)(H,20,27)/t10-,13-,14+,15-/m1/s1 |
| InChIKey | ZHTSDPRCEDKUPB-QPKOPYBWSA-N |
| XLogP | -3.01 |
| TPSA | 187.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|