C27H46N2O10 — CID 177428132
3,4,5-tributoxy-N-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]ethyl]benzamide (PubChem CID 177428132) has the molecular formula C27H46N2O10 and a molecular weight of 558.67 g/mol. Its IUPAC name is 3,4,5-tributoxy-N-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]ethyl]benzamide.
| Compound Name | 3,4,5-tributoxy-N-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 177428132 |
| Molecular Formula | C27H46N2O10 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 3,4,5-tributoxy-N-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]ethyl]benzamide |
| SMILES | CCCCOc1cc(C(=O)NCCNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc(OCCCC)c1OCCCC |
| InChI | InChI=1S/C27H46N2O10/c1-4-7-12-37-20-15-18(16-21(38-13-8-5-2)25(20)39-14-9-6-3)26(35)28-10-11-29-27(36)24(34)23(33)22(32)19(31)17-30/h15-16,19,22-24,30-34H,4-14,17H2,1-3H3,(H,28,35)(H,29,36)/t19-,22-,23+,24-/m1/s1 |
| InChIKey | ZTMWZUIBCKSKRS-OUJCMCIWSA-N |
| XLogP | 0.51 |
| TPSA | 187.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|