C16H15N3O6 — CID 3120163
3,4-dimethoxy-N'-(2-nitrobenzoyl)benzohydrazide (PubChem CID 3120163) has the molecular formula C16H15N3O6 and a molecular weight of 345.31 g/mol. Its IUPAC name is 3,4-dimethoxy-N'-(2-nitrobenzoyl)benzohydrazide.
| Compound Name | 3,4-dimethoxy-N'-(2-nitrobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 3120163 |
| Molecular Formula | C16H15N3O6 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3,4-dimethoxy-N'-(2-nitrobenzoyl)benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H15N3O6/c1-24-13-8-7-10(9-14(13)25-2)15(20)17-18-16(21)11-5-3-4-6-12(11)19(22)23/h3-9H,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | GPSPOODELKFVNE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|