C19H17NO7 — CID 10937566
1-(3,4-dimethoxyphenyl)-5-(2-nitrophenyl)pentane-1,3,5-trione (PubChem CID 10937566) has the molecular formula C19H17NO7 and a molecular weight of 371.35 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-5-(2-nitrophenyl)pentane-1,3,5-trione.
| Compound Name | 1-(3,4-dimethoxyphenyl)-5-(2-nitrophenyl)pentane-1,3,5-trione |
|---|---|
| PubChem CID | 10937566 |
| Molecular Formula | C19H17NO7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-5-(2-nitrophenyl)pentane-1,3,5-trione |
| SMILES | COc1ccc(C(=O)CC(=O)CC(=O)c2ccccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H17NO7/c1-26-18-8-7-12(9-19(18)27-2)16(22)10-13(21)11-17(23)14-5-3-4-6-15(14)20(24)25/h3-9H,10-11H2,1-2H3 |
| InChIKey | RCMHAAWCBJMITM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|