C10H9BrN4O2S — CID 9154765
N'-(5-bromothiophene-2-carbonyl)-1-methylpyrazole-4-carbohydrazide (PubChem CID 9154765) has the molecular formula C10H9BrN4O2S and a molecular weight of 329.18 g/mol. Its IUPAC name is N'-(5-bromothiophene-2-carbonyl)-1-methylpyrazole-4-carbohydrazide.
| Compound Name | N'-(5-bromothiophene-2-carbonyl)-1-methylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9154765 |
| Molecular Formula | C10H9BrN4O2S |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | N'-(5-bromothiophene-2-carbonyl)-1-methylpyrazole-4-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)c2ccc(Br)s2)cn1 |
| InChI | InChI=1S/C10H9BrN4O2S/c1-15-5-6(4-12-15)9(16)13-14-10(17)7-2-3-8(11)18-7/h2-5H,1H3,(H,13,16)(H,14,17) |
| InChIKey | FHFNDIHPBKLITM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|