C24H23NO6S — CID 55916883
methyl 2-[4-[[4-(benzenesulfonylmethyl)benzoyl]amino]-3-methylphenoxy]acetate (PubChem CID 55916883) has the molecular formula C24H23NO6S and a molecular weight of 453.52 g/mol. Its IUPAC name is methyl 2-[4-[[4-(benzenesulfonylmethyl)benzoyl]amino]-3-methylphenoxy]acetate.
| Compound Name | methyl 2-[4-[[4-(benzenesulfonylmethyl)benzoyl]amino]-3-methylphenoxy]acetate |
|---|---|
| PubChem CID | 55916883 |
| Molecular Formula | C24H23NO6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | methyl 2-[4-[[4-(benzenesulfonylmethyl)benzoyl]amino]-3-methylphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)c2ccc(CS(=O)(=O)c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C24H23NO6S/c1-17-14-20(31-15-23(26)30-2)12-13-22(17)25-24(27)19-10-8-18(9-11-19)16-32(28,29)21-6-4-3-5-7-21/h3-14H,15-16H2,1-2H3,(H,25,27) |
| InChIKey | SAGIQFPZPWBSKN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |