C24H18F3N3O3S — CID 55759697
4-(benzenesulfonylmethyl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 55759697) has the molecular formula C24H18F3N3O3S and a molecular weight of 485.49 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(benzenesulfonylmethyl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55759697 |
| Molecular Formula | C24H18F3N3O3S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1-n1cccn1)c1ccc(CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18F3N3O3S/c25-24(26,27)19-11-12-22(30-14-4-13-28-30)21(15-19)29-23(31)18-9-7-17(8-10-18)16-34(32,33)20-5-2-1-3-6-20/h1-15H,16H2,(H,29,31) |
| InChIKey | RPXAVZYWZFPPMB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |