C19H15F4N3O2 — CID 26725790
2-(3-fluoro-4-methoxyphenyl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 26725790) has the molecular formula C19H15F4N3O2 and a molecular weight of 393.34 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 26725790 |
| Molecular Formula | C19H15F4N3O2 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2cc(C(F)(F)F)ccc2-n2cccn2)cc1F |
| InChI | InChI=1S/C19H15F4N3O2/c1-28-17-6-3-12(9-14(17)20)10-18(27)25-15-11-13(19(21,22)23)4-5-16(15)26-8-2-7-24-26/h2-9,11H,10H2,1H3,(H,25,27) |
| InChIKey | SPVOWHPQCVRIRU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |