C19H14F5N3O3 — CID 26725553
4-(difluoromethoxy)-3-methoxy-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 26725553) has the molecular formula C19H14F5N3O3 and a molecular weight of 427.33 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-methoxy-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-3-methoxy-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26725553 |
| Molecular Formula | C19H14F5N3O3 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-(difluoromethoxy)-3-methoxy-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2cc(C(F)(F)F)ccc2-n2cccn2)ccc1OC(F)F |
| InChI | InChI=1S/C19H14F5N3O3/c1-29-16-9-11(3-6-15(16)30-18(20)21)17(28)26-13-10-12(19(22,23)24)4-5-14(13)27-8-2-7-25-27/h2-10,18H,1H3,(H,26,28) |
| InChIKey | OZUIQJXHWHSPGQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |