C16H9Cl2F3N4O — CID 46616651
5,6-dichloro-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 46616651) has the molecular formula C16H9Cl2F3N4O and a molecular weight of 401.18 g/mol. Its IUPAC name is 5,6-dichloro-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46616651 |
| Molecular Formula | C16H9Cl2F3N4O |
| Molecular Weight | 401.18 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 5,6-dichloro-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1-n1cccn1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H9Cl2F3N4O/c17-11-6-9(8-22-14(11)18)15(26)24-12-7-10(16(19,20)21)2-3-13(12)25-5-1-4-23-25/h1-8H,(H,24,26) |
| InChIKey | NWFBLYGRQDFQKO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.18 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|