C17H18F3N3O2 — CID 51117583
2-cyclopentyloxy-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 51117583) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is 2-cyclopentyloxy-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-cyclopentyloxy-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 51117583 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-cyclopentyloxy-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(COC1CCCC1)Nc1cc(C(F)(F)F)ccc1-n1cccn1 |
| InChI | InChI=1S/C17H18F3N3O2/c18-17(19,20)12-6-7-15(23-9-3-8-21-23)14(10-12)22-16(24)11-25-13-4-1-2-5-13/h3,6-10,13H,1-2,4-5,11H2,(H,22,24) |
| InChIKey | ACZCSSHLPAXJET-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |