C17H11F3N3O4S- — CID 8844382
4-[[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 8844382) has the molecular formula C17H11F3N3O4S- and a molecular weight of 410.35 g/mol. Its IUPAC name is 4-[[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | 4-[[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8844382 |
| Molecular Formula | C17H11F3N3O4S- |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 4-[[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | O=C([O-])c1ccc(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2-n2cccn2)cc1 |
| InChI | InChI=1S/C17H12F3N3O4S/c18-17(19,20)12-4-7-15(23-9-1-8-21-23)14(10-12)22-28(26,27)13-5-2-11(3-6-13)16(24)25/h1-10,22H,(H,24,25)/p-1 |
| InChIKey | JPSQNBBTPRCNJG-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |