C18H14F3N3O4S — CID 26489724
methyl 4-[[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate (PubChem CID 26489724) has the molecular formula C18H14F3N3O4S and a molecular weight of 425.39 g/mol. Its IUPAC name is methyl 4-[[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 26489724 |
| Molecular Formula | C18H14F3N3O4S |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | methyl 4-[[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2-n2cccn2)cc1 |
| InChI | InChI=1S/C18H14F3N3O4S/c1-28-17(25)12-3-6-14(7-4-12)29(26,27)23-15-11-13(18(19,20)21)5-8-16(15)24-10-2-9-22-24/h2-11,23H,1H3 |
| InChIKey | KOGJQZZLIMSCJB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |