C22H20ClNO3S — CID 55758138
4-(benzenesulfonylmethyl)-N-[1-(2-chlorophenyl)ethyl]benzamide (PubChem CID 55758138) has the molecular formula C22H20ClNO3S and a molecular weight of 413.93 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-N-[1-(2-chlorophenyl)ethyl]benzamide.
| Compound Name | 4-(benzenesulfonylmethyl)-N-[1-(2-chlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55758138 |
| Molecular Formula | C22H20ClNO3S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-N-[1-(2-chlorophenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(CS(=O)(=O)c2ccccc2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C22H20ClNO3S/c1-16(20-9-5-6-10-21(20)23)24-22(25)18-13-11-17(12-14-18)15-28(26,27)19-7-3-2-4-8-19/h2-14,16H,15H2,1H3,(H,24,25) |
| InChIKey | GWXJSSYJPHSGIP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |