C18H16ClN3O3S2 — CID 87487830
N-[1-(2-chlorophenyl)ethyl]-4-(1,3-thiazol-2-ylsulfamoyl)benzamide (PubChem CID 87487830) has the molecular formula C18H16ClN3O3S2 and a molecular weight of 421.93 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)ethyl]-4-(1,3-thiazol-2-ylsulfamoyl)benzamide.
| Compound Name | N-[1-(2-chlorophenyl)ethyl]-4-(1,3-thiazol-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 87487830 |
| Molecular Formula | C18H16ClN3O3S2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | N-[1-(2-chlorophenyl)ethyl]-4-(1,3-thiazol-2-ylsulfamoyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(S(=O)(=O)Nc2nccs2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C18H16ClN3O3S2/c1-12(15-4-2-3-5-16(15)19)21-17(23)13-6-8-14(9-7-13)27(24,25)22-18-20-10-11-26-18/h2-12H,1H3,(H,20,22)(H,21,23) |
| InChIKey | IQBIOXCPSDATLC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |