C21H20N2O4S — CID 49202399
N-[2-(benzenesulfonamido)phenyl]-4-(methoxymethyl)benzamide (PubChem CID 49202399) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)phenyl]-4-(methoxymethyl)benzamide.
| Compound Name | N-[2-(benzenesulfonamido)phenyl]-4-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 49202399 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[2-(benzenesulfonamido)phenyl]-4-(methoxymethyl)benzamide |
| SMILES | COCc1ccc(C(=O)Nc2ccccc2NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O4S/c1-27-15-16-11-13-17(14-12-16)21(24)22-19-9-5-6-10-20(19)23-28(25,26)18-7-3-2-4-8-18/h2-14,23H,15H2,1H3,(H,22,24) |
| InChIKey | PHXGNQBDLHPNKK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |