C20H16N2O3S — CID 171762168
CID 171762168 (PubChem CID 171762168) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol.
| Compound Name | CID 171762168 |
|---|---|
| PubChem CID | 171762168 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | — |
| SMILES | [CH]c1ccc(S(=O)(=O)Nc2ccccc2NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16N2O3S/c1-15-11-13-17(14-12-15)26(24,25)22-19-10-6-5-9-18(19)21-20(23)16-7-3-2-4-8-16/h1-14,22H,(H,21,23) |
| InChIKey | VYVIYXXJTNMLGX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |