C18H25NO6S — CID 120545898
2-[[4-(2-methoxyethylsulfonyl)benzoyl]amino]-2-methylcyclohexane-1-carboxylic acid (PubChem CID 120545898) has the molecular formula C18H25NO6S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[[4-(2-methoxyethylsulfonyl)benzoyl]amino]-2-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[[4-(2-methoxyethylsulfonyl)benzoyl]amino]-2-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120545898 |
| Molecular Formula | C18H25NO6S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[[4-(2-methoxyethylsulfonyl)benzoyl]amino]-2-methylcyclohexane-1-carboxylic acid |
| SMILES | COCCS(=O)(=O)c1ccc(C(=O)NC2(C)CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C18H25NO6S/c1-18(10-4-3-5-15(18)17(21)22)19-16(20)13-6-8-14(9-7-13)26(23,24)12-11-25-2/h6-9,15H,3-5,10-12H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | XUQBZJWTYDXCLE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |