C20H27NO5 — CID 120545390
2-methyl-2-[[4-(oxan-4-yloxy)benzoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 120545390) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-methyl-2-[[4-(oxan-4-yloxy)benzoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 2-methyl-2-[[4-(oxan-4-yloxy)benzoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120545390 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-methyl-2-[[4-(oxan-4-yloxy)benzoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CC1(NC(=O)c2ccc(OC3CCOCC3)cc2)CCCCC1C(=O)O |
| InChI | InChI=1S/C20H27NO5/c1-20(11-3-2-4-17(20)19(23)24)21-18(22)14-5-7-15(8-6-14)26-16-9-12-25-13-10-16/h5-8,16-17H,2-4,9-13H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | GJNHYHPHQOXTIP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |