C14H21ClN2O4S — CID 119451105
4-(2-methoxyethylsulfonyl)-N-pyrrolidin-3-ylbenzamide;hydrochloride (PubChem CID 119451105) has the molecular formula C14H21ClN2O4S and a molecular weight of 348.85 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfonyl)-N-pyrrolidin-3-ylbenzamide;hydrochloride.
| Compound Name | 4-(2-methoxyethylsulfonyl)-N-pyrrolidin-3-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119451105 |
| Molecular Formula | C14H21ClN2O4S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 4-(2-methoxyethylsulfonyl)-N-pyrrolidin-3-ylbenzamide;hydrochloride |
| SMILES | COCCS(=O)(=O)c1ccc(C(=O)NC2CCNC2)cc1.Cl |
| InChI | InChI=1S/C14H20N2O4S.ClH/c1-20-8-9-21(18,19)13-4-2-11(3-5-13)14(17)16-12-6-7-15-10-12;/h2-5,12,15H,6-10H2,1H3,(H,16,17);1H |
| InChIKey | TUCIASXSACIWHI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |