C21H35ClN2O — CID 162755757
4-decyl-N-[(3S)-pyrrolidin-3-yl]benzamide;hydrochloride (PubChem CID 162755757) has the molecular formula C21H35ClN2O and a molecular weight of 366.98 g/mol. Its IUPAC name is 4-decyl-N-[(3S)-pyrrolidin-3-yl]benzamide;hydrochloride.
| Compound Name | 4-decyl-N-[(3S)-pyrrolidin-3-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 162755757 |
| Molecular Formula | C21H35ClN2O |
| Molecular Weight | 366.98 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-decyl-N-[(3S)-pyrrolidin-3-yl]benzamide;hydrochloride |
| SMILES | CCCCCCCCCCc1ccc(C(=O)N[C@H]2CCNC2)cc1.Cl |
| InChI | InChI=1S/C21H34N2O.ClH/c1-2-3-4-5-6-7-8-9-10-18-11-13-19(14-12-18)21(24)23-20-15-16-22-17-20;/h11-14,20,22H,2-10,15-17H2,1H3,(H,23,24);1H/t20-;/m0./s1 |
| InChIKey | IWDMYEUWTCMKFI-BDQAORGHSA-N |
| XLogP | 4.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.98 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|