C12H18F2N2S — CID 61360208
4-[2-(diethylamino)ethylsulfanyl]-3,5-difluoroaniline (PubChem CID 61360208) has the molecular formula C12H18F2N2S and a molecular weight of 260.35 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethylsulfanyl]-3,5-difluoroaniline.
| Compound Name | 4-[2-(diethylamino)ethylsulfanyl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 61360208 |
| Molecular Formula | C12H18F2N2S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-[2-(diethylamino)ethylsulfanyl]-3,5-difluoroaniline |
| SMILES | CCN(CC)CCSc1c(F)cc(N)cc1F |
| InChI | InChI=1S/C12H18F2N2S/c1-3-16(4-2)5-6-17-12-10(13)7-9(15)8-11(12)14/h7-8H,3-6,15H2,1-2H3 |
| InChIKey | IIFWQRZXLBUMTC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|