C13H20N4S — CID 61358076
2-[2-(diethylamino)ethylsulfanyl]-3H-benzimidazol-5-amine (PubChem CID 61358076) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylsulfanyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[2-(diethylamino)ethylsulfanyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 61358076 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-[2-(diethylamino)ethylsulfanyl]-3H-benzimidazol-5-amine |
| SMILES | CCN(CC)CCSc1nc2ccc(N)cc2[nH]1 |
| InChI | InChI=1S/C13H20N4S/c1-3-17(4-2)7-8-18-13-15-11-6-5-10(14)9-12(11)16-13/h5-6,9H,3-4,7-8,14H2,1-2H3,(H,15,16) |
| InChIKey | MKQYMQLAXMQHOW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|