C10H10F3N3S — CID 64566971
2-(3,3,3-trifluoropropylsulfanyl)-3H-benzimidazol-5-amine (PubChem CID 64566971) has the molecular formula C10H10F3N3S and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropylsulfanyl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(3,3,3-trifluoropropylsulfanyl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 64566971 |
| Molecular Formula | C10H10F3N3S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2-(3,3,3-trifluoropropylsulfanyl)-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(SCCC(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C10H10F3N3S/c11-10(12,13)3-4-17-9-15-7-2-1-6(14)5-8(7)16-9/h1-2,5H,3-4,14H2,(H,15,16) |
| InChIKey | KYXQLQNMDLMRQG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|