C12H14F3N3S — CID 84614974
4-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanyl]butan-1-amine (PubChem CID 84614974) has the molecular formula C12H14F3N3S and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanyl]butan-1-amine.
| Compound Name | 4-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanyl]butan-1-amine |
|---|---|
| PubChem CID | 84614974 |
| Molecular Formula | C12H14F3N3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanyl]butan-1-amine |
| SMILES | NCCCCSc1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C12H14F3N3S/c13-12(14,15)8-3-4-9-10(7-8)18-11(17-9)19-6-2-1-5-16/h3-4,7H,1-2,5-6,16H2,(H,17,18) |
| InChIKey | IRXQSJCYIMISCL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|