C8H4F4N2 — CID 131028936
2-fluoro-6-(trifluoromethyl)-1H-benzimidazole (PubChem CID 131028936) has the molecular formula C8H4F4N2 and a molecular weight of 204.13 g/mol. Its IUPAC name is 2-fluoro-6-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 2-fluoro-6-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 131028936 |
| Molecular Formula | C8H4F4N2 |
| Molecular Weight | 204.13 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 2-fluoro-6-(trifluoromethyl)-1H-benzimidazole |
| SMILES | Fc1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C8H4F4N2/c9-7-13-5-2-1-4(8(10,11)12)3-6(5)14-7/h1-3H,(H,13,14) |
| InChIKey | LANMYIBYFWSISG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.13 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |