C9H9F3N2O4S — CID 144728382
methanol;6-(trifluoromethyl)-1H-benzimidazole-2-sulfonic acid (PubChem CID 144728382) has the molecular formula C9H9F3N2O4S and a molecular weight of 298.24 g/mol. Its IUPAC name is methanol;6-(trifluoromethyl)-1H-benzimidazole-2-sulfonic acid.
| Compound Name | methanol;6-(trifluoromethyl)-1H-benzimidazole-2-sulfonic acid |
|---|---|
| PubChem CID | 144728382 |
| Molecular Formula | C9H9F3N2O4S |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | methanol;6-(trifluoromethyl)-1H-benzimidazole-2-sulfonic acid |
| SMILES | CO.O=S(=O)(O)c1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C8H5F3N2O3S.CH4O/c9-8(10,11)4-1-2-5-6(3-4)13-7(12-5)17(14,15)16;1-2/h1-3H,(H,12,13)(H,14,15,16);2H,1H3 |
| InChIKey | DRKAUMXMSHAWDM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|