C13H15F3N2O4 — CID 162542970
(3R)-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]pentane-1,2,3,4-tetrol (PubChem CID 162542970) has the molecular formula C13H15F3N2O4 and a molecular weight of 320.27 g/mol. Its IUPAC name is (3R)-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]pentane-1,2,3,4-tetrol.
| Compound Name | (3R)-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 162542970 |
| Molecular Formula | C13H15F3N2O4 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (3R)-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]pentane-1,2,3,4-tetrol |
| SMILES | CC(O)[C@@H](O)C(O)C(O)c1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C13H15F3N2O4/c1-5(19)9(20)10(21)11(22)12-17-7-3-2-6(13(14,15)16)4-8(7)18-12/h2-5,9-11,19-22H,1H3,(H,17,18)/t5?,9-,10?,11?/m1/s1 |
| InChIKey | WTTOOFHJIBFNCJ-VCKYEMLCSA-N |
| XLogP | 0.72 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |