C10H12Cl2F3N3 — CID 161165676
1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethanamine;dihydrochloride (PubChem CID 161165676) has the molecular formula C10H12Cl2F3N3 and a molecular weight of 302.13 g/mol. Its IUPAC name is 1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethanamine;dihydrochloride.
| Compound Name | 1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 161165676 |
| Molecular Formula | C10H12Cl2F3N3 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethanamine;dihydrochloride |
| SMILES | CC(N)c1nc2ccc(C(F)(F)F)cc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C10H10F3N3.2ClH/c1-5(14)9-15-7-3-2-6(10(11,12)13)4-8(7)16-9;;/h2-5H,14H2,1H3,(H,15,16);2*1H |
| InChIKey | UQMRNTZRBSDEEP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |