C11H17N3O — CID 143560224
methanol;(1S)-1-(6-methyl-1H-benzimidazol-2-yl)ethanamine (PubChem CID 143560224) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is methanol;(1S)-1-(6-methyl-1H-benzimidazol-2-yl)ethanamine.
| Compound Name | methanol;(1S)-1-(6-methyl-1H-benzimidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 143560224 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | methanol;(1S)-1-(6-methyl-1H-benzimidazol-2-yl)ethanamine |
| SMILES | CO.Cc1ccc2nc([C@H](C)N)[nH]c2c1 |
| InChI | InChI=1S/C10H13N3.CH4O/c1-6-3-4-8-9(5-6)13-10(12-8)7(2)11;1-2/h3-5,7H,11H2,1-2H3,(H,12,13);2H,1H3/t7-;/m0./s1 |
| InChIKey | CYXMSYWYAQKZNC-FJXQXJEOSA-N |
| XLogP | 1.50 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |