C18H18N4O2 — CID 653921
1,2-bis(6-methyl-1H-benzimidazol-2-yl)ethane-1,2-diol (PubChem CID 653921) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 1,2-bis(6-methyl-1H-benzimidazol-2-yl)ethane-1,2-diol.
| Compound Name | 1,2-bis(6-methyl-1H-benzimidazol-2-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 653921 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1,2-bis(6-methyl-1H-benzimidazol-2-yl)ethane-1,2-diol |
| SMILES | Cc1ccc2nc(C(O)C(O)c3nc4ccc(C)cc4[nH]3)[nH]c2c1 |
| InChI | InChI=1S/C18H18N4O2/c1-9-3-5-11-13(7-9)21-17(19-11)15(23)16(24)18-20-12-6-4-10(2)8-14(12)22-18/h3-8,15-16,23-24H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | UVQBVNCTDLEOPI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |