C16H16N6O2 — CID 765476
(1R,2S)-1,2-bis(6-amino-1H-benzimidazol-2-yl)ethane-1,2-diol (PubChem CID 765476) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is (1R,2S)-1,2-bis(6-amino-1H-benzimidazol-2-yl)ethane-1,2-diol.
| Compound Name | (1R,2S)-1,2-bis(6-amino-1H-benzimidazol-2-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 765476 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (1R,2S)-1,2-bis(6-amino-1H-benzimidazol-2-yl)ethane-1,2-diol |
| SMILES | Nc1ccc2nc([C@@H](O)[C@@H](O)c3nc4ccc(N)cc4[nH]3)[nH]c2c1 |
| InChI | InChI=1S/C16H16N6O2/c17-7-1-3-9-11(5-7)21-15(19-9)13(23)14(24)16-20-10-4-2-8(18)6-12(10)22-16/h1-6,13-14,23-24H,17-18H2,(H,19,21)(H,20,22)/t13-,14+ |
| InChIKey | AMCLDAPTSDAGKG-OKILXGFUSA-N |
| XLogP | 1.37 |
| TPSA | 149.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|