C16H12F2N4O2 — CID 6927588
(1S,2S)-1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol (PubChem CID 6927588) has the molecular formula C16H12F2N4O2 and a molecular weight of 330.29 g/mol. Its IUPAC name is (1S,2S)-1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol.
| Compound Name | (1S,2S)-1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 6927588 |
| Molecular Formula | C16H12F2N4O2 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (1S,2S)-1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol |
| SMILES | O[C@@H](c1nc2ccc(F)cc2[nH]1)[C@@H](O)c1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C16H12F2N4O2/c17-7-1-3-9-11(5-7)21-15(19-9)13(23)14(24)16-20-10-4-2-8(18)6-12(10)22-16/h1-6,13-14,23-24H,(H,19,21)(H,20,22)/t13-,14-/m1/s1 |
| InChIKey | GATVUWZGDBORAV-ZIAGYGMSSA-N |
| XLogP | 2.48 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |