C11H10F3N3O — CID 136900820
2-(1-aminoethyl)-6-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 136900820) has the molecular formula C11H10F3N3O and a molecular weight of 257.22 g/mol. Its IUPAC name is 2-(1-aminoethyl)-6-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 2-(1-aminoethyl)-6-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136900820 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-(1-aminoethyl)-6-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | CC(N)c1nc2ccc(C(F)(F)F)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H10F3N3O/c1-5(15)9-16-8-3-2-6(11(12,13)14)4-7(8)10(18)17-9/h2-5H,15H2,1H3,(H,16,17,18) |
| InChIKey | ZAKQYSUOLORSOX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |