C10H9ClN2O2 — CID 137201177
6-chloro-2-[(1R)-1-hydroxyethyl]-3H-quinazolin-4-one (PubChem CID 137201177) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is 6-chloro-2-[(1R)-1-hydroxyethyl]-3H-quinazolin-4-one.
| Compound Name | 6-chloro-2-[(1R)-1-hydroxyethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137201177 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 6-chloro-2-[(1R)-1-hydroxyethyl]-3H-quinazolin-4-one |
| SMILES | C[C@@H](O)c1nc2ccc(Cl)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C10H9ClN2O2/c1-5(14)9-12-8-3-2-6(11)4-7(8)10(15)13-9/h2-5,14H,1H3,(H,12,13,15)/t5-/m1/s1 |
| InChIKey | VBOAEYWMPGMFJI-RXMQYKEDSA-N |
| XLogP | 1.63 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |