C19H14Cl2N2O — CID 136730776
6-chloro-2-[(1Z,3Z)-1-chloro-3-methyl-4-phenylbuta-1,3-dienyl]-3H-quinazolin-4-one (PubChem CID 136730776) has the molecular formula C19H14Cl2N2O and a molecular weight of 357.24 g/mol. Its IUPAC name is 6-chloro-2-[(1Z,3Z)-1-chloro-3-methyl-4-phenylbuta-1,3-dienyl]-3H-quinazolin-4-one.
| Compound Name | 6-chloro-2-[(1Z,3Z)-1-chloro-3-methyl-4-phenylbuta-1,3-dienyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136730776 |
| Molecular Formula | C19H14Cl2N2O |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 6-chloro-2-[(1Z,3Z)-1-chloro-3-methyl-4-phenylbuta-1,3-dienyl]-3H-quinazolin-4-one |
| SMILES | CC(=C/c1ccccc1)/C=C(\Cl)c1nc2ccc(Cl)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H14Cl2N2O/c1-12(9-13-5-3-2-4-6-13)10-16(21)18-22-17-8-7-14(20)11-15(17)19(24)23-18/h2-11H,1H3,(H,22,23,24)/b12-9-,16-10- |
| InChIKey | CYEQJSAILISKQR-MNXDUIDKSA-N |
| XLogP | 5.26 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|