C20H19Cl2N3O — CID 135817927
6-chloro-2-[(Z)-1-chloro-2-[4-(diethylamino)phenyl]ethenyl]-3H-quinazolin-4-one (PubChem CID 135817927) has the molecular formula C20H19Cl2N3O and a molecular weight of 388.30 g/mol. Its IUPAC name is 6-chloro-2-[(Z)-1-chloro-2-[4-(diethylamino)phenyl]ethenyl]-3H-quinazolin-4-one.
| Compound Name | 6-chloro-2-[(Z)-1-chloro-2-[4-(diethylamino)phenyl]ethenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135817927 |
| Molecular Formula | C20H19Cl2N3O |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 6-chloro-2-[(Z)-1-chloro-2-[4-(diethylamino)phenyl]ethenyl]-3H-quinazolin-4-one |
| SMILES | CCN(CC)c1ccc(/C=C(\Cl)c2nc3ccc(Cl)cc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O/c1-3-25(4-2)15-8-5-13(6-9-15)11-17(22)19-23-18-10-7-14(21)12-16(18)20(26)24-19/h5-12H,3-4H2,1-2H3,(H,23,24,26)/b17-11- |
| InChIKey | WWFIDQOFQXHQKP-BOPFTXTBSA-N |
| XLogP | 5.16 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|