C17H9Cl2N3O — CID 135488318
4-[2-chloro-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethenyl]benzonitrile (PubChem CID 135488318) has the molecular formula C17H9Cl2N3O and a molecular weight of 342.19 g/mol. Its IUPAC name is 4-[2-chloro-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethenyl]benzonitrile.
| Compound Name | 4-[2-chloro-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 135488318 |
| Molecular Formula | C17H9Cl2N3O |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 4-[2-chloro-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)ethenyl]benzonitrile |
| SMILES | N#Cc1ccc(C=C(Cl)c2nc3cc(Cl)ccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C17H9Cl2N3O/c18-12-5-6-13-15(8-12)21-16(22-17(13)23)14(19)7-10-1-3-11(9-20)4-2-10/h1-8H,(H,21,22,23) |
| InChIKey | ZBJHZADIJBAMDS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |