C17H12Cl2N2O — CID 135847238
7-chloro-2-[(Z)-1-chloro-2-(3-methylphenyl)ethenyl]-3H-quinazolin-4-one (PubChem CID 135847238) has the molecular formula C17H12Cl2N2O and a molecular weight of 331.20 g/mol. Its IUPAC name is 7-chloro-2-[(Z)-1-chloro-2-(3-methylphenyl)ethenyl]-3H-quinazolin-4-one.
| Compound Name | 7-chloro-2-[(Z)-1-chloro-2-(3-methylphenyl)ethenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135847238 |
| Molecular Formula | C17H12Cl2N2O |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 7-chloro-2-[(Z)-1-chloro-2-(3-methylphenyl)ethenyl]-3H-quinazolin-4-one |
| SMILES | Cc1cccc(/C=C(\Cl)c2nc3cc(Cl)ccc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C17H12Cl2N2O/c1-10-3-2-4-11(7-10)8-14(19)16-20-15-9-12(18)5-6-13(15)17(22)21-16/h2-9H,1H3,(H,20,21,22)/b14-8- |
| InChIKey | ZEUFUBWDEOQZNN-ZSOIEALJSA-N |
| XLogP | 4.62 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |