C16H9Cl3N2O — CID 137300044
2-[(Z)-1-chloro-2-(2,4-dichlorophenyl)ethenyl]-3H-quinazolin-4-one (PubChem CID 137300044) has the molecular formula C16H9Cl3N2O and a molecular weight of 351.62 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(2,4-dichlorophenyl)ethenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(Z)-1-chloro-2-(2,4-dichlorophenyl)ethenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137300044 |
| Molecular Formula | C16H9Cl3N2O |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(2,4-dichlorophenyl)ethenyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(/C(Cl)=C/c2ccc(Cl)cc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C16H9Cl3N2O/c17-10-6-5-9(12(18)8-10)7-13(19)15-20-14-4-2-1-3-11(14)16(22)21-15/h1-8H,(H,20,21,22)/b13-7- |
| InChIKey | JBOBCDQNTRSADK-QPEQYQDCSA-N |
| XLogP | 4.97 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |