C20H13ClN4O — CID 135960496
2-[(E)-1-chloro-2-(2-phenylpyrimidin-5-yl)ethenyl]-3H-quinazolin-4-one (PubChem CID 135960496) has the molecular formula C20H13ClN4O and a molecular weight of 360.80 g/mol. Its IUPAC name is 2-[(E)-1-chloro-2-(2-phenylpyrimidin-5-yl)ethenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(E)-1-chloro-2-(2-phenylpyrimidin-5-yl)ethenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135960496 |
| Molecular Formula | C20H13ClN4O |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-[(E)-1-chloro-2-(2-phenylpyrimidin-5-yl)ethenyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(/C(Cl)=C\c2cnc(-c3ccccc3)nc2)nc2ccccc12 |
| InChI | InChI=1S/C20H13ClN4O/c21-16(19-24-17-9-5-4-8-15(17)20(26)25-19)10-13-11-22-18(23-12-13)14-6-2-1-3-7-14/h1-12H,(H,24,25,26)/b16-10+ |
| InChIKey | BOSMZORBYZAFIR-MHWRWJLKSA-N |
| XLogP | 4.12 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |