C18H14Cl2N2O3 — CID 135612820
2-[(Z)-1-chloro-2-(3-chloro-5-ethoxy-4-hydroxyphenyl)ethenyl]-3H-quinazolin-4-one (PubChem CID 135612820) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(3-chloro-5-ethoxy-4-hydroxyphenyl)ethenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(Z)-1-chloro-2-(3-chloro-5-ethoxy-4-hydroxyphenyl)ethenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135612820 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(3-chloro-5-ethoxy-4-hydroxyphenyl)ethenyl]-3H-quinazolin-4-one |
| SMILES | CCOc1cc(/C=C(\Cl)c2nc3ccccc3c(=O)[nH]2)cc(Cl)c1O |
| InChI | InChI=1S/C18H14Cl2N2O3/c1-2-25-15-9-10(7-12(19)16(15)23)8-13(20)17-21-14-6-4-3-5-11(14)18(24)22-17/h3-9,23H,2H2,1H3,(H,21,22,24)/b13-8- |
| InChIKey | WYEWWPMOQIWJTI-JYRVWZFOSA-N |
| XLogP | 4.42 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |