C16H10ClFN2O — CID 135847750
2-[(Z)-1-chloro-2-(4-fluorophenyl)ethenyl]-3H-quinazolin-4-one (PubChem CID 135847750) has the molecular formula C16H10ClFN2O and a molecular weight of 300.72 g/mol. Its IUPAC name is 2-[(Z)-1-chloro-2-(4-fluorophenyl)ethenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(Z)-1-chloro-2-(4-fluorophenyl)ethenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135847750 |
| Molecular Formula | C16H10ClFN2O |
| Molecular Weight | 300.72 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[(Z)-1-chloro-2-(4-fluorophenyl)ethenyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(/C(Cl)=C/c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C16H10ClFN2O/c17-13(9-10-5-7-11(18)8-6-10)15-19-14-4-2-1-3-12(14)16(21)20-15/h1-9H,(H,19,20,21)/b13-9- |
| InChIKey | UDQLFPFJCOXNSW-LCYFTJDESA-N |
| XLogP | 3.80 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.72 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |