C10H9ClN2O2 — CID 175805927
6-chloro-2-ethoxy-3H-quinazolin-4-one (PubChem CID 175805927) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is 6-chloro-2-ethoxy-3H-quinazolin-4-one.
| Compound Name | 6-chloro-2-ethoxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 175805927 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 6-chloro-2-ethoxy-3H-quinazolin-4-one |
| SMILES | CCOc1nc2ccc(Cl)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C10H9ClN2O2/c1-2-15-10-12-8-4-3-6(11)5-7(8)9(14)13-10/h3-5H,2H2,1H3,(H,12,13,14) |
| InChIKey | IKCUDUINRQRFQQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |