C12H10F3IN2O — CID 178097427
6-iodo-2-propan-2-yl-7-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 178097427) has the molecular formula C12H10F3IN2O and a molecular weight of 382.12 g/mol. Its IUPAC name is 6-iodo-2-propan-2-yl-7-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 6-iodo-2-propan-2-yl-7-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 178097427 |
| Molecular Formula | C12H10F3IN2O |
| Molecular Weight | 382.12 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 6-iodo-2-propan-2-yl-7-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | CC(C)c1nc2cc(C(F)(F)F)c(I)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H10F3IN2O/c1-5(2)10-17-9-4-7(12(13,14)15)8(16)3-6(9)11(19)18-10/h3-5H,1-2H3,(H,17,18,19) |
| InChIKey | KMIVGFDMCRDWOL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.12 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|