C22H34F3N3O2Si — CID 178097390
6-[1-amino-3-tri(propan-2-yl)silyloxypropyl]-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 178097390) has the molecular formula C22H34F3N3O2Si and a molecular weight of 457.61 g/mol. Its IUPAC name is 6-[1-amino-3-tri(propan-2-yl)silyloxypropyl]-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 6-[1-amino-3-tri(propan-2-yl)silyloxypropyl]-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 178097390 |
| Molecular Formula | C22H34F3N3O2Si |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 6-[1-amino-3-tri(propan-2-yl)silyloxypropyl]-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | Cc1nc2cc(C(F)(F)F)c(C(N)CCO[Si](C(C)C)(C(C)C)C(C)C)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C22H34F3N3O2Si/c1-12(2)31(13(3)4,14(5)6)30-9-8-19(26)16-10-17-20(11-18(16)22(23,24)25)27-15(7)28-21(17)29/h10-14,19H,8-9,26H2,1-7H3,(H,27,28,29) |
| InChIKey | SZQURQXAVOLECO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|