C15H18F3N3OS — CID 178097651
2-methylpropane;2-methyl-6-[(E)-sulfanyliminomethyl]-7-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 178097651) has the molecular formula C15H18F3N3OS and a molecular weight of 345.39 g/mol. Its IUPAC name is 2-methylpropane;2-methyl-6-[(E)-sulfanyliminomethyl]-7-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 2-methylpropane;2-methyl-6-[(E)-sulfanyliminomethyl]-7-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 178097651 |
| Molecular Formula | C15H18F3N3OS |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-methylpropane;2-methyl-6-[(E)-sulfanyliminomethyl]-7-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | CC(C)C.Cc1nc2cc(C(F)(F)F)c(/C=N/S)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H8F3N3OS.C4H10/c1-5-16-9-3-8(11(12,13)14)6(4-15-19)2-7(9)10(18)17-5;1-4(2)3/h2-4,19H,1H3,(H,16,17,18);4H,1-3H3/b15-4+; |
| InChIKey | JIDJHFBDJKRUBW-HDNKIUSMSA-N |
| XLogP | 4.18 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|