C11H8BrF3N2O — CID 178097192
6-bromo-2,5-dimethyl-7-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 178097192) has the molecular formula C11H8BrF3N2O and a molecular weight of 321.10 g/mol. Its IUPAC name is 6-bromo-2,5-dimethyl-7-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 6-bromo-2,5-dimethyl-7-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 178097192 |
| Molecular Formula | C11H8BrF3N2O |
| Molecular Weight | 321.10 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 6-bromo-2,5-dimethyl-7-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | Cc1nc2cc(C(F)(F)F)c(Br)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C11H8BrF3N2O/c1-4-8-7(16-5(2)17-10(8)18)3-6(9(4)12)11(13,14)15/h3H,1-2H3,(H,16,17,18) |
| InChIKey | VSVLRFQWCZBRDD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.10 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |