C12H11BrF3N3O — CID 178097786
6-(1-aminoethyl)-8-bromo-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one (PubChem CID 178097786) has the molecular formula C12H11BrF3N3O and a molecular weight of 350.14 g/mol. Its IUPAC name is 6-(1-aminoethyl)-8-bromo-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one.
| Compound Name | 6-(1-aminoethyl)-8-bromo-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 178097786 |
| Molecular Formula | C12H11BrF3N3O |
| Molecular Weight | 350.14 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 6-(1-aminoethyl)-8-bromo-2-methyl-7-(trifluoromethyl)-3H-quinazolin-4-one |
| SMILES | Cc1nc2c(Br)c(C(F)(F)F)c(C(C)N)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H11BrF3N3O/c1-4(17)6-3-7-10(18-5(2)19-11(7)20)9(13)8(6)12(14,15)16/h3-4H,17H2,1-2H3,(H,18,19,20) |
| InChIKey | RJFYIWCSUFWDAX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.14 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |